About 2,6-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione
2,6-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione (PubChem CID 146657619) has the molecular formula C22H30O3
and a molecular weight of 342.48 g/mol. Its IUPAC name is 2,6-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione.
Molecular Properties
| Compound Name | 2,6-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione |
| PubChem CID | 146657619 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 2,6-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione |
| SMILES | CCCCCC1=C(C)C(=O)C2=C(OC(C)(CCC=C(C)C)C=C2)C1=O |
| InChI | InChI=1S/C22H30O3/c1-6-7-8-11-17-16(4)19(23)18-12-14-22(5,13-9-10-15(2)3)25-21(18)20(17)24/h10,12,14H,6-9,11,13H2,1-5H3 |
| InChIKey | XIZBYDBRRMZNNB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione?
The IUPAC name of 2,6-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione (CID 146657619) is 2,6-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione.
What is the SMILES notation for 2,6-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione?
The canonical SMILES for 2,6-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione is CCCCCC1=C(C)C(=O)C2=C(OC(C)(CCC=C(C)C)C=C2)C1=O.
What is the InChIKey of 2,6-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione?
The InChIKey is XIZBYDBRRMZNNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30O3/c1-6-7-8-11-17-16(4)19(23)18-12-14-22(5,13-9-10-15(2)3)25-21(18)20(17)24/h10,12,14H,6-9,11,13H2,1-5H3.
What are the key properties of 2,6-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione?
2,6-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione has a molecular weight of 342.48 g/mol, XLogP of 5.38, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione is sourced from PubChem (CID 146657619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).