About 2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione
2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione (PubChem CID 146657629) has the molecular formula C21H28O3
and a molecular weight of 328.45 g/mol. Its IUPAC name is 2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione.
Molecular Properties
| Compound Name | 2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione |
| PubChem CID | 146657629 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione |
| SMILES | CCCCCC1=CC(=O)C2=C(OC(C)(CCC=C(C)C)C=C2)C1=O |
| InChI | InChI=1S/C21H28O3/c1-5-6-7-10-16-14-18(22)17-11-13-21(4,12-8-9-15(2)3)24-20(17)19(16)23/h9,11,13-14H,5-8,10,12H2,1-4H3 |
| InChIKey | HEBMMRMWLSDVHO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione?
The IUPAC name of 2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione (CID 146657629) is 2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione.
What is the SMILES notation for 2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione?
The canonical SMILES for 2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione is CCCCCC1=CC(=O)C2=C(OC(C)(CCC=C(C)C)C=C2)C1=O.
What is the InChIKey of 2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione?
The InChIKey is HEBMMRMWLSDVHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O3/c1-5-6-7-10-16-14-18(22)17-11-13-21(4,12-8-9-15(2)3)24-20(17)19(16)23/h9,11,13-14H,5-8,10,12H2,1-4H3.
What are the key properties of 2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione?
2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione has a molecular weight of 328.45 g/mol, XLogP of 4.99, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromene-5,8-dione is sourced from PubChem (CID 146657629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).