C31H44O3 — CID 146657632
2-methyl-7-pentyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]chromene-5,8-dione (PubChem CID 146657632) has the molecular formula C31H44O3 and a molecular weight of 464.69 g/mol. Its IUPAC name is 2-methyl-7-pentyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]chromene-5,8-dione.
| Compound Name | 2-methyl-7-pentyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]chromene-5,8-dione |
|---|---|
| PubChem CID | 146657632 |
| Molecular Formula | C31H44O3 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | 2-methyl-7-pentyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]chromene-5,8-dione |
| SMILES | CCCCCC1=CC(=O)C2=C(OC(C)(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C=C2)C1=O |
| InChI | InChI=1S/C31H44O3/c1-7-8-9-18-26-22-28(32)27-19-21-31(6,34-30(27)29(26)33)20-12-17-25(5)16-11-15-24(4)14-10-13-23(2)3/h13,15,17,19,21-22H,7-12,14,16,18,20H2,1-6H3/b24-15+,25-17+ |
| InChIKey | FVVHSNBFZXMMDI-WXCFVEPLSA-N |
| XLogP | 8.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|