C28H30N2 — CID 146658038
7-cyclohepta-1,3,5-trien-1-yl-4-cyclohexa-1,3-dien-1-yl-2,9-dimethyl-2,5,6,11-tetrahydro-1H-pyrido[3,2-i][2]benzazepine (PubChem CID 146658038) has the molecular formula C28H30N2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 7-cyclohepta-1,3,5-trien-1-yl-4-cyclohexa-1,3-dien-1-yl-2,9-dimethyl-2,5,6,11-tetrahydro-1H-pyrido[3,2-i][2]benzazepine.
| Compound Name | 7-cyclohepta-1,3,5-trien-1-yl-4-cyclohexa-1,3-dien-1-yl-2,9-dimethyl-2,5,6,11-tetrahydro-1H-pyrido[3,2-i][2]benzazepine |
|---|---|
| PubChem CID | 146658038 |
| Molecular Formula | C28H30N2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 7-cyclohepta-1,3,5-trien-1-yl-4-cyclohexa-1,3-dien-1-yl-2,9-dimethyl-2,5,6,11-tetrahydro-1H-pyrido[3,2-i][2]benzazepine |
| SMILES | CC1=NCC2=C(CCC3=C2NC(C)C=C3C2=CC=CCC2)C(C2=CC=CC=CC2)=C1 |
| InChI | InChI=1S/C28H30N2/c1-19-16-25(21-10-6-3-4-7-11-21)23-14-15-24-26(22-12-8-5-9-13-22)17-20(2)30-28(24)27(23)18-29-19/h3-8,10,12,16-17,20,30H,9,11,13-15,18H2,1-2H3 |
| InChIKey | PZUOQCBUZWTKDJ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |