C18H21NO2 — CID 146658252
4-[(5'R)-5'-hydroxy-2',5',7'-trimethyl-4'-oxospiro[cyclopropane-1,6'-indene]-1'-yl]butanenitrile (PubChem CID 146658252) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 4-[(5'R)-5'-hydroxy-2',5',7'-trimethyl-4'-oxospiro[cyclopropane-1,6'-indene]-1'-yl]butanenitrile.
| Compound Name | 4-[(5'R)-5'-hydroxy-2',5',7'-trimethyl-4'-oxospiro[cyclopropane-1,6'-indene]-1'-yl]butanenitrile |
|---|---|
| PubChem CID | 146658252 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 4-[(5'R)-5'-hydroxy-2',5',7'-trimethyl-4'-oxospiro[cyclopropane-1,6'-indene]-1'-yl]butanenitrile |
| SMILES | CC1=C(CCCC#N)C2=C(C)C3(CC3)[C@@](C)(O)C(=O)C2=C1 |
| InChI | InChI=1S/C18H21NO2/c1-11-10-14-15(13(11)6-4-5-9-19)12(2)18(7-8-18)17(3,21)16(14)20/h10,21H,4-8H2,1-3H3/t17-/m0/s1 |
| InChIKey | KOYMLWOQUQCBGT-KRWDZBQOSA-N |
| XLogP | 3.37 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|