C22H40N4 — CID 146658570
1-N-[(ethenylamino)methyl]-4-N,3,3-trimethyl-1-N-[1-(methylamino)ethenyl]-4-N-[(3Z,5Z)-octa-3,5,7-trien-4-yl]pentane-1,4-diamine (PubChem CID 146658570) has the molecular formula C22H40N4 and a molecular weight of 360.59 g/mol. Its IUPAC name is 1-N-[(ethenylamino)methyl]-4-N,3,3-trimethyl-1-N-[1-(methylamino)ethenyl]-4-N-[(3Z,5Z)-octa-3,5,7-trien-4-yl]pentane-1,4-diamine.
| Compound Name | 1-N-[(ethenylamino)methyl]-4-N,3,3-trimethyl-1-N-[1-(methylamino)ethenyl]-4-N-[(3Z,5Z)-octa-3,5,7-trien-4-yl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 146658570 |
| Molecular Formula | C22H40N4 |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.33 |
| IUPAC Name | 1-N-[(ethenylamino)methyl]-4-N,3,3-trimethyl-1-N-[1-(methylamino)ethenyl]-4-N-[(3Z,5Z)-octa-3,5,7-trien-4-yl]pentane-1,4-diamine |
| SMILES | C=C/C=C\C(=C\CC)N(C)C(C)C(C)(C)CCN(CNC=C)C(=C)NC |
| InChI | InChI=1S/C22H40N4/c1-10-13-15-21(14-11-2)25(9)19(4)22(6,7)16-17-26(18-24-12-3)20(5)23-8/h10,12-15,19,23-24H,1,3,5,11,16-18H2,2,4,6-9H3/b15-13-,21-14- |
| InChIKey | WXKJXFWYUBGYGN-GRMZDKMOSA-N |
| XLogP | 4.44 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|