About 1-(4,4-difluorocyclohexyl)-6-ethylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one
1-(4,4-difluorocyclohexyl)-6-ethylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 146659096) has the molecular formula C13H16F2N4OS
and a molecular weight of 314.36 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-6-ethylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 1-(4,4-difluorocyclohexyl)-6-ethylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 146659096 |
| Molecular Formula | C13H16F2N4OS |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-6-ethylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCSc1nc2c(cnn2C2CCC(F)(F)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H16F2N4OS/c1-2-21-12-17-10-9(11(20)18-12)7-16-19(10)8-3-5-13(14,15)6-4-8/h7-8H,2-6H2,1H3,(H,17,18,20) |
| InChIKey | BYDVRAICFLFPAH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4,4-difluorocyclohexyl)-6-ethylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-difluorocyclohexyl)-6-ethylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 1-(4,4-difluorocyclohexyl)-6-ethylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (CID 146659096) is 1-(4,4-difluorocyclohexyl)-6-ethylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 1-(4,4-difluorocyclohexyl)-6-ethylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 1-(4,4-difluorocyclohexyl)-6-ethylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one is CCSc1nc2c(cnn2C2CCC(F)(F)CC2)c(=O)[nH]1.
What is the InChIKey of 1-(4,4-difluorocyclohexyl)-6-ethylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is BYDVRAICFLFPAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F2N4OS/c1-2-21-12-17-10-9(11(20)18-12)7-16-19(10)8-3-5-13(14,15)6-4-8/h7-8H,2-6H2,1H3,(H,17,18,20).
What are the key properties of 1-(4,4-difluorocyclohexyl)-6-ethylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
1-(4,4-difluorocyclohexyl)-6-ethylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 314.36 g/mol, XLogP of 2.98, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-difluorocyclohexyl)-6-ethylsulfanyl-5H-pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 146659096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).