C21H34O3 — CID 146659376
2-[(3R,5R,8R,10S,13R,17R)-3-hydroxy-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]acetic acid (PubChem CID 146659376) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 2-[(3R,5R,8R,10S,13R,17R)-3-hydroxy-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]acetic acid.
| Compound Name | 2-[(3R,5R,8R,10S,13R,17R)-3-hydroxy-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]acetic acid |
|---|---|
| PubChem CID | 146659376 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 2-[(3R,5R,8R,10S,13R,17R)-3-hydroxy-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]acetic acid |
| SMILES | C[C@@]1(O)CC[C@@H]2C3CC[C@@]4(C)C(CC[C@@H]4CC(=O)O)[C@@H]3CC[C@@H]2C1 |
| InChI | InChI=1S/C21H34O3/c1-20(24)9-7-15-13(12-20)3-5-17-16(15)8-10-21(2)14(11-19(22)23)4-6-18(17)21/h13-18,24H,3-12H2,1-2H3,(H,22,23)/t13-,14-,15+,16?,17-,18?,20-,21-/m1/s1 |
| InChIKey | XFOTYFMKCCSCNC-RCZUAPPDSA-N |
| XLogP | 4.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |