About 5-ethenyl-N,2-dimethyl-6-methylidene-1H-pyrimidin-4-amine
5-ethenyl-N,2-dimethyl-6-methylidene-1H-pyrimidin-4-amine (PubChem CID 146659525) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 5-ethenyl-N,2-dimethyl-6-methylidene-1H-pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-ethenyl-N,2-dimethyl-6-methylidene-1H-pyrimidin-4-amine |
| PubChem CID | 146659525 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 5-ethenyl-N,2-dimethyl-6-methylidene-1H-pyrimidin-4-amine |
| SMILES | C=CC1=C(NC)N=C(C)NC1=C |
| InChI | InChI=1S/C9H13N3/c1-5-8-6(2)11-7(3)12-9(8)10-4/h5,10H,1-2H2,3-4H3,(H,11,12) |
| InChIKey | ALDJYEZBTJVULX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethenyl-N,2-dimethyl-6-methylidene-1H-pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-N,2-dimethyl-6-methylidene-1H-pyrimidin-4-amine?
The IUPAC name of 5-ethenyl-N,2-dimethyl-6-methylidene-1H-pyrimidin-4-amine (CID 146659525) is 5-ethenyl-N,2-dimethyl-6-methylidene-1H-pyrimidin-4-amine.
What is the SMILES notation for 5-ethenyl-N,2-dimethyl-6-methylidene-1H-pyrimidin-4-amine?
The canonical SMILES for 5-ethenyl-N,2-dimethyl-6-methylidene-1H-pyrimidin-4-amine is C=CC1=C(NC)N=C(C)NC1=C.
What is the InChIKey of 5-ethenyl-N,2-dimethyl-6-methylidene-1H-pyrimidin-4-amine?
The InChIKey is ALDJYEZBTJVULX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-5-8-6(2)11-7(3)12-9(8)10-4/h5,10H,1-2H2,3-4H3,(H,11,12).
What are the key properties of 5-ethenyl-N,2-dimethyl-6-methylidene-1H-pyrimidin-4-amine?
5-ethenyl-N,2-dimethyl-6-methylidene-1H-pyrimidin-4-amine has a molecular weight of 163.22 g/mol, XLogP of 1.14, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-N,2-dimethyl-6-methylidene-1H-pyrimidin-4-amine is sourced from PubChem (CID 146659525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).