C18H26FN — CID 146660440
(8R)-N-(2-bicyclo[4.1.0]hepta-1(7),2,4-trienyl)-8-fluoro-5-methyldecan-1-imine (PubChem CID 146660440) has the molecular formula C18H26FN and a molecular weight of 275.41 g/mol. Its IUPAC name is (8R)-N-(2-bicyclo[4.1.0]hepta-1(7),2,4-trienyl)-8-fluoro-5-methyldecan-1-imine.
| Compound Name | (8R)-N-(2-bicyclo[4.1.0]hepta-1(7),2,4-trienyl)-8-fluoro-5-methyldecan-1-imine |
|---|---|
| PubChem CID | 146660440 |
| Molecular Formula | C18H26FN |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | (8R)-N-(2-bicyclo[4.1.0]hepta-1(7),2,4-trienyl)-8-fluoro-5-methyldecan-1-imine |
| SMILES | CC[C@@H](F)CCC(C)CCC/C=N/C1=CC=CC2C=C12 |
| InChI | InChI=1S/C18H26FN/c1-3-16(19)11-10-14(2)7-4-5-12-20-18-9-6-8-15-13-17(15)18/h6,8-9,12-16H,3-5,7,10-11H2,1-2H3/b20-12+/t14?,15?,16-/m1/s1 |
| InChIKey | MJLNGBFPHJBPFH-KKYNLLAESA-N |
| XLogP | 5.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|