About 3-methoxy-4-prop-1-en-2-yloxy-2,3-dihydro-1H-pyrrole
3-methoxy-4-prop-1-en-2-yloxy-2,3-dihydro-1H-pyrrole (PubChem CID 146660683) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is 3-methoxy-4-prop-1-en-2-yloxy-2,3-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 3-methoxy-4-prop-1-en-2-yloxy-2,3-dihydro-1H-pyrrole |
| PubChem CID | 146660683 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 3-methoxy-4-prop-1-en-2-yloxy-2,3-dihydro-1H-pyrrole |
| SMILES | C=C(C)OC1=CNCC1OC |
| InChI | InChI=1S/C8H13NO2/c1-6(2)11-8-5-9-4-7(8)10-3/h5,7,9H,1,4H2,2-3H3 |
| InChIKey | FPAUGNBUZMHBNO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-4-prop-1-en-2-yloxy-2,3-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-4-prop-1-en-2-yloxy-2,3-dihydro-1H-pyrrole?
The IUPAC name of 3-methoxy-4-prop-1-en-2-yloxy-2,3-dihydro-1H-pyrrole (CID 146660683) is 3-methoxy-4-prop-1-en-2-yloxy-2,3-dihydro-1H-pyrrole.
What is the SMILES notation for 3-methoxy-4-prop-1-en-2-yloxy-2,3-dihydro-1H-pyrrole?
The canonical SMILES for 3-methoxy-4-prop-1-en-2-yloxy-2,3-dihydro-1H-pyrrole is C=C(C)OC1=CNCC1OC.
What is the InChIKey of 3-methoxy-4-prop-1-en-2-yloxy-2,3-dihydro-1H-pyrrole?
The InChIKey is FPAUGNBUZMHBNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c1-6(2)11-8-5-9-4-7(8)10-3/h5,7,9H,1,4H2,2-3H3.
What are the key properties of 3-methoxy-4-prop-1-en-2-yloxy-2,3-dihydro-1H-pyrrole?
3-methoxy-4-prop-1-en-2-yloxy-2,3-dihydro-1H-pyrrole has a molecular weight of 155.20 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4-prop-1-en-2-yloxy-2,3-dihydro-1H-pyrrole is sourced from PubChem (CID 146660683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).