C20H26O10 — CID 146660885
[(2R,3R,4S,5R)-3,5-diacetyloxy-4-methoxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate (PubChem CID 146660885) has the molecular formula C20H26O10 and a molecular weight of 426.42 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,5-diacetyloxy-4-methoxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,5-diacetyloxy-4-methoxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 146660885 |
| Molecular Formula | C20H26O10 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | [(2R,3R,4S,5R)-3,5-diacetyloxy-4-methoxy-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(OC2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C20H26O10/c1-11(21)26-10-16-17(27-12(2)22)18(25-5)19(28-13(3)23)20(30-16)29-15-8-6-14(24-4)7-9-15/h6-9,16-20H,10H2,1-5H3/t16-,17-,18+,19-,20?/m1/s1 |
| InChIKey | QEKCSRLRGYXBDN-QUIYGKKVSA-N |
| XLogP | 1.24 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|