C23H27F2N5 — CID 146661110
(E,3Z)-3-[4-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1-methylpyrimidin-2-ylidene]-N-(propan-2-ylideneamino)pent-4-en-2-imine (PubChem CID 146661110) has the molecular formula C23H27F2N5 and a molecular weight of 411.50 g/mol. Its IUPAC name is (E,3Z)-3-[4-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1-methylpyrimidin-2-ylidene]-N-(propan-2-ylideneamino)pent-4-en-2-imine.
| Compound Name | (E,3Z)-3-[4-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1-methylpyrimidin-2-ylidene]-N-(propan-2-ylideneamino)pent-4-en-2-imine |
|---|---|
| PubChem CID | 146661110 |
| Molecular Formula | C23H27F2N5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | (E,3Z)-3-[4-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1-methylpyrimidin-2-ylidene]-N-(propan-2-ylideneamino)pent-4-en-2-imine |
| SMILES | C=CC(/C(C)=N\N=C(C)C)=C1/N=C(N2CCCC2c2cc(F)ccc2F)C=CN1C |
| InChI | InChI=1S/C23H27F2N5/c1-6-18(16(4)28-27-15(2)3)23-26-22(11-13-29(23)5)30-12-7-8-21(30)19-14-17(24)9-10-20(19)25/h6,9-11,13-14,21H,1,7-8,12H2,2-5H3/b23-18+,28-16+ |
| InChIKey | NKMIAYOKXAHJOZ-ZAVVBMRFSA-N |
| XLogP | 5.21 |
| TPSA | 43.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|