About 1-cyclohexyl-3-methoxy-3,6-dihydro-2H-pyridine
1-cyclohexyl-3-methoxy-3,6-dihydro-2H-pyridine (PubChem CID 146661404) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-cyclohexyl-3-methoxy-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-methoxy-3,6-dihydro-2H-pyridine |
| PubChem CID | 146661404 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 1-cyclohexyl-3-methoxy-3,6-dihydro-2H-pyridine |
| SMILES | COC1C=CCN(C2CCCCC2)C1 |
| InChI | InChI=1S/C12H21NO/c1-14-12-8-5-9-13(10-12)11-6-3-2-4-7-11/h5,8,11-12H,2-4,6-7,9-10H2,1H3 |
| InChIKey | GSJDLKUTMQINAZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-3-methoxy-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-methoxy-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-cyclohexyl-3-methoxy-3,6-dihydro-2H-pyridine (CID 146661404) is 1-cyclohexyl-3-methoxy-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-cyclohexyl-3-methoxy-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-cyclohexyl-3-methoxy-3,6-dihydro-2H-pyridine is COC1C=CCN(C2CCCCC2)C1.
What is the InChIKey of 1-cyclohexyl-3-methoxy-3,6-dihydro-2H-pyridine?
The InChIKey is GSJDLKUTMQINAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-14-12-8-5-9-13(10-12)11-6-3-2-4-7-11/h5,8,11-12H,2-4,6-7,9-10H2,1H3.
What are the key properties of 1-cyclohexyl-3-methoxy-3,6-dihydro-2H-pyridine?
1-cyclohexyl-3-methoxy-3,6-dihydro-2H-pyridine has a molecular weight of 195.31 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-methoxy-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 146661404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).