C25H26ClF2N7 — CID 146661755
6-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-N-[2-(4-ethylpiperazin-1-yl)ethyl]-1,5-naphthyridin-3-amine (PubChem CID 146661755) has the molecular formula C25H26ClF2N7 and a molecular weight of 497.98 g/mol. Its IUPAC name is 6-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-N-[2-(4-ethylpiperazin-1-yl)ethyl]-1,5-naphthyridin-3-amine.
| Compound Name | 6-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-N-[2-(4-ethylpiperazin-1-yl)ethyl]-1,5-naphthyridin-3-amine |
|---|---|
| PubChem CID | 146661755 |
| Molecular Formula | C25H26ClF2N7 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 6-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-N-[2-(4-ethylpiperazin-1-yl)ethyl]-1,5-naphthyridin-3-amine |
| SMILES | CCN1CCN(CCNc2cnc3ccc(-c4cn[nH]c4-c4cc(Cl)c(F)cc4F)nc3c2)CC1 |
| InChI | InChI=1S/C25H26ClF2N7/c1-2-34-7-9-35(10-8-34)6-5-29-16-11-24-23(30-14-16)4-3-22(32-24)18-15-31-33-25(18)17-12-19(26)21(28)13-20(17)27/h3-4,11-15,29H,2,5-10H2,1H3,(H,31,33) |
| InChIKey | BCJHEZCMSAKGTO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|