C27H23ClF2N6 — CID 146661843
trans-(1R,2R)-2-[4-[6-[5-(5-chloro-2,4-difluorophenyl)-1H-imidazol-4-yl]quinolin-3-yl]pyrazol-1-yl]cyclohexan-1-amine (PubChem CID 146661843) has the molecular formula C27H23ClF2N6 and a molecular weight of 504.97 g/mol. Its IUPAC name is trans-(1R,2R)-2-[4-[6-[5-(5-chloro-2,4-difluorophenyl)-1H-imidazol-4-yl]quinolin-3-yl]pyrazol-1-yl]cyclohexan-1-amine.
| Compound Name | trans-(1R,2R)-2-[4-[6-[5-(5-chloro-2,4-difluorophenyl)-1H-imidazol-4-yl]quinolin-3-yl]pyrazol-1-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 146661843 |
| Molecular Formula | C27H23ClF2N6 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | trans-(1R,2R)-2-[4-[6-[5-(5-chloro-2,4-difluorophenyl)-1H-imidazol-4-yl]quinolin-3-yl]pyrazol-1-yl]cyclohexan-1-amine |
| SMILES | N[C@@H]1CCCC[C@H]1n1cc(-c2cnc3ccc(-c4nc[nH]c4-c4cc(Cl)c(F)cc4F)cc3c2)cn1 |
| InChI | InChI=1S/C27H23ClF2N6/c28-20-9-19(21(29)10-22(20)30)27-26(33-14-34-27)15-5-6-24-16(7-15)8-17(11-32-24)18-12-35-36(13-18)25-4-2-1-3-23(25)31/h5-14,23,25H,1-4,31H2,(H,33,34)/t23-,25-/m1/s1 |
| InChIKey | LFOTUGFDRCSJHP-ILBGXUMGSA-N |
| XLogP | 6.53 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|