C28H21ClFN9 — CID 146661926
2-[5-(5-chloro-2-fluorophenyl)-1H-pyrazol-4-yl]-7-[1-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-ylmethyl)triazol-4-yl]-1,5-naphthyridine (PubChem CID 146661926) has the molecular formula C28H21ClFN9 and a molecular weight of 537.99 g/mol. Its IUPAC name is 2-[5-(5-chloro-2-fluorophenyl)-1H-pyrazol-4-yl]-7-[1-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-ylmethyl)triazol-4-yl]-1,5-naphthyridine.
| Compound Name | 2-[5-(5-chloro-2-fluorophenyl)-1H-pyrazol-4-yl]-7-[1-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-ylmethyl)triazol-4-yl]-1,5-naphthyridine |
|---|---|
| PubChem CID | 146661926 |
| Molecular Formula | C28H21ClFN9 |
| Molecular Weight | 537.99 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 2-[5-(5-chloro-2-fluorophenyl)-1H-pyrazol-4-yl]-7-[1-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-ylmethyl)triazol-4-yl]-1,5-naphthyridine |
| SMILES | Fc1ccc(Cl)cc1-c1[nH]ncc1-c1ccc2ncc(-c3cn(Cc4cnc5c(c4)CNCC5)nn3)cc2n1 |
| InChI | InChI=1S/C28H21ClFN9/c29-19-1-2-22(30)20(9-19)28-21(13-34-37-28)24-3-4-25-26(35-24)8-18(12-33-25)27-15-39(38-36-27)14-16-7-17-11-31-6-5-23(17)32-10-16/h1-4,7-10,12-13,15,31H,5-6,11,14H2,(H,34,37) |
| InChIKey | AKSXNYOLIQRJCU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.99 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |