C16H10BrFN2O — CID 146661979
2-(7-bromo-1,5-naphthyridin-2-yl)-1-(2-fluorophenyl)ethanone (PubChem CID 146661979) has the molecular formula C16H10BrFN2O and a molecular weight of 345.17 g/mol. Its IUPAC name is 2-(7-bromo-1,5-naphthyridin-2-yl)-1-(2-fluorophenyl)ethanone.
| Compound Name | 2-(7-bromo-1,5-naphthyridin-2-yl)-1-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 146661979 |
| Molecular Formula | C16H10BrFN2O |
| Molecular Weight | 345.17 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 2-(7-bromo-1,5-naphthyridin-2-yl)-1-(2-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc2ncc(Br)cc2n1)c1ccccc1F |
| InChI | InChI=1S/C16H10BrFN2O/c17-10-7-15-14(19-9-10)6-5-11(20-15)8-16(21)12-3-1-2-4-13(12)18/h1-7,9H,8H2 |
| InChIKey | QZBBUERIMICULX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.17 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |