C28H20ClF2N9 — CID 146661995
2-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-7-[1-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-ylmethyl)triazol-4-yl]-1,5-naphthyridine (PubChem CID 146661995) has the molecular formula C28H20ClF2N9 and a molecular weight of 555.98 g/mol. Its IUPAC name is 2-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-7-[1-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-ylmethyl)triazol-4-yl]-1,5-naphthyridine.
| Compound Name | 2-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-7-[1-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-ylmethyl)triazol-4-yl]-1,5-naphthyridine |
|---|---|
| PubChem CID | 146661995 |
| Molecular Formula | C28H20ClF2N9 |
| Molecular Weight | 555.98 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | 2-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-7-[1-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-ylmethyl)triazol-4-yl]-1,5-naphthyridine |
| SMILES | Fc1cc(F)c(-c2[nH]ncc2-c2ccc3ncc(-c4cn(Cc5cnc6c(c5)CNCC6)nn4)cc3n2)cc1Cl |
| InChI | InChI=1S/C28H20ClF2N9/c29-20-7-18(21(30)8-22(20)31)28-19(12-35-38-28)24-1-2-25-26(36-24)6-17(11-34-25)27-14-40(39-37-27)13-15-5-16-10-32-4-3-23(16)33-9-15/h1-2,5-9,11-12,14,32H,3-4,10,13H2,(H,35,38) |
| InChIKey | BALZETPGNYVRIT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.98 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|