About 7-bromo-2-[2-(5-chloro-2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1,5-naphthyridine
7-bromo-2-[2-(5-chloro-2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1,5-naphthyridine (PubChem CID 146662062) has the molecular formula C21H11BrClFN4
and a molecular weight of 453.70 g/mol. Its IUPAC name is 7-bromo-2-[2-(5-chloro-2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1,5-naphthyridine.
Molecular Properties
| Compound Name | 7-bromo-2-[2-(5-chloro-2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1,5-naphthyridine |
| PubChem CID | 146662062 |
| Molecular Formula | C21H11BrClFN4 |
| Molecular Weight | 453.70 g/mol |
| Exact Mass | 451.98 |
| IUPAC Name | 7-bromo-2-[2-(5-chloro-2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1,5-naphthyridine |
| SMILES | Fc1ccc(Cl)cc1-c1nc2ccccn2c1-c1ccc2ncc(Br)cc2n1 |
| InChI | InChI=1S/C21H11BrClFN4/c22-12-9-18-16(25-11-12)6-7-17(26-18)21-20(14-10-13(23)4-5-15(14)24)27-19-3-1-2-8-28(19)21/h1-11H |
| InChIKey | ZILGVUAJIXWVJZ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.70 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-bromo-2-[2-(5-chloro-2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-[2-(5-chloro-2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1,5-naphthyridine?
The IUPAC name of 7-bromo-2-[2-(5-chloro-2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1,5-naphthyridine (CID 146662062) is 7-bromo-2-[2-(5-chloro-2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1,5-naphthyridine.
What is the SMILES notation for 7-bromo-2-[2-(5-chloro-2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1,5-naphthyridine?
The canonical SMILES for 7-bromo-2-[2-(5-chloro-2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1,5-naphthyridine is Fc1ccc(Cl)cc1-c1nc2ccccn2c1-c1ccc2ncc(Br)cc2n1.
What is the InChIKey of 7-bromo-2-[2-(5-chloro-2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1,5-naphthyridine?
The InChIKey is ZILGVUAJIXWVJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H11BrClFN4/c22-12-9-18-16(25-11-12)6-7-17(26-18)21-20(14-10-13(23)4-5-15(14)24)27-19-3-1-2-8-28(19)21/h1-11H.
What are the key properties of 7-bromo-2-[2-(5-chloro-2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1,5-naphthyridine?
7-bromo-2-[2-(5-chloro-2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1,5-naphthyridine has a molecular weight of 453.70 g/mol, XLogP of 6.17, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-[2-(5-chloro-2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]-1,5-naphthyridine is sourced from PubChem (CID 146662062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).