About 7-bromo-2-[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridine
7-bromo-2-[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridine (PubChem CID 146662093) has the molecular formula C17H9BrF2N4
and a molecular weight of 387.19 g/mol. Its IUPAC name is 7-bromo-2-[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridine.
Molecular Properties
| Compound Name | 7-bromo-2-[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridine |
| PubChem CID | 146662093 |
| Molecular Formula | C17H9BrF2N4 |
| Molecular Weight | 387.19 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | 7-bromo-2-[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridine |
| SMILES | Fc1ccc(-c2[nH]ncc2-c2ccc3ncc(Br)cc3n2)cc1F |
| InChI | InChI=1S/C17H9BrF2N4/c18-10-6-16-15(21-7-10)4-3-14(23-16)11-8-22-24-17(11)9-1-2-12(19)13(20)5-9/h1-8H,(H,22,24) |
| InChIKey | QNEIUANSOYXYNQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.19 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-2-[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridine?
The IUPAC name of 7-bromo-2-[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridine (CID 146662093) is 7-bromo-2-[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridine.
What is the SMILES notation for 7-bromo-2-[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridine?
The canonical SMILES for 7-bromo-2-[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridine is Fc1ccc(-c2[nH]ncc2-c2ccc3ncc(Br)cc3n2)cc1F.
What is the InChIKey of 7-bromo-2-[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridine?
The InChIKey is QNEIUANSOYXYNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9BrF2N4/c18-10-6-16-15(21-7-10)4-3-14(23-16)11-8-22-24-17(11)9-1-2-12(19)13(20)5-9/h1-8H,(H,22,24).
What are the key properties of 7-bromo-2-[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridine?
7-bromo-2-[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridine has a molecular weight of 387.19 g/mol, XLogP of 4.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-[5-(3,4-difluorophenyl)-1H-pyrazol-4-yl]-1,5-naphthyridine is sourced from PubChem (CID 146662093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).