C24H18ClFN4O — CID 146662229
2-[3-(5-chloro-2-fluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-7-ethynyl-1,5-naphthyridine (PubChem CID 146662229) has the molecular formula C24H18ClFN4O and a molecular weight of 432.89 g/mol. Its IUPAC name is 2-[3-(5-chloro-2-fluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-7-ethynyl-1,5-naphthyridine.
| Compound Name | 2-[3-(5-chloro-2-fluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-7-ethynyl-1,5-naphthyridine |
|---|---|
| PubChem CID | 146662229 |
| Molecular Formula | C24H18ClFN4O |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 2-[3-(5-chloro-2-fluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-7-ethynyl-1,5-naphthyridine |
| SMILES | C#Cc1cnc2ccc(-c3cn(C4CCCCO4)nc3-c3cc(Cl)ccc3F)nc2c1 |
| InChI | InChI=1S/C24H18ClFN4O/c1-2-15-11-22-21(27-13-15)9-8-20(28-22)18-14-30(23-5-3-4-10-31-23)29-24(18)17-12-16(25)6-7-19(17)26/h1,6-9,11-14,23H,3-5,10H2 |
| InChIKey | LETZSFNUQUERSA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|