C18H23N — CID 146662322
1-cyclohexa-1,5-dien-1-yl-N-(2-cyclohexa-2,4-dien-1-ylpropan-2-yl)prop-2-en-1-imine (PubChem CID 146662322) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-N-(2-cyclohexa-2,4-dien-1-ylpropan-2-yl)prop-2-en-1-imine.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-N-(2-cyclohexa-2,4-dien-1-ylpropan-2-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 146662322 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-N-(2-cyclohexa-2,4-dien-1-ylpropan-2-yl)prop-2-en-1-imine |
| SMILES | C=C/C(=N\C(C)(C)C1C=CC=CC1)C1=CCCC=C1 |
| InChI | InChI=1S/C18H23N/c1-4-17(15-11-7-5-8-12-15)19-18(2,3)16-13-9-6-10-14-16/h4,6-7,9-13,16H,1,5,8,14H2,2-3H3/b19-17+ |
| InChIKey | NHSKSNHTNAPDJY-HTXNQAPBSA-N |
| XLogP | 4.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|