C23H22FN7O3S — CID 146662346
3-[2-[4-[(3-fluoro-2-pyridinyl)methylamino]-[1,3]thiazolo[4,5-c]pyridin-2-yl]ethylamino]-N-(2-nitrophenyl)propanamide (PubChem CID 146662346) has the molecular formula C23H22FN7O3S and a molecular weight of 495.54 g/mol. Its IUPAC name is 3-[2-[4-[(3-fluoro-2-pyridinyl)methylamino]-[1,3]thiazolo[4,5-c]pyridin-2-yl]ethylamino]-N-(2-nitrophenyl)propanamide.
| Compound Name | 3-[2-[4-[(3-fluoro-2-pyridinyl)methylamino]-[1,3]thiazolo[4,5-c]pyridin-2-yl]ethylamino]-N-(2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 146662346 |
| Molecular Formula | C23H22FN7O3S |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 3-[2-[4-[(3-fluoro-2-pyridinyl)methylamino]-[1,3]thiazolo[4,5-c]pyridin-2-yl]ethylamino]-N-(2-nitrophenyl)propanamide |
| SMILES | O=C(CCNCCc1nc2c(NCc3ncccc3F)nccc2s1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H22FN7O3S/c24-15-4-3-10-26-17(15)14-28-23-22-19(7-13-27-23)35-21(30-22)9-12-25-11-8-20(32)29-16-5-1-2-6-18(16)31(33)34/h1-7,10,13,25H,8-9,11-12,14H2,(H,27,28)(H,29,32) |
| InChIKey | GXTRWSDJDFTBMX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|