C22H20F2N8O3S — CID 146662381
N-(5-fluoro-2-nitrophenyl)-3-[2-[7-[(3-fluoro-2-pyridinyl)methylamino]-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]ethylamino]propanamide (PubChem CID 146662381) has the molecular formula C22H20F2N8O3S and a molecular weight of 514.52 g/mol. Its IUPAC name is N-(5-fluoro-2-nitrophenyl)-3-[2-[7-[(3-fluoro-2-pyridinyl)methylamino]-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]ethylamino]propanamide.
| Compound Name | N-(5-fluoro-2-nitrophenyl)-3-[2-[7-[(3-fluoro-2-pyridinyl)methylamino]-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]ethylamino]propanamide |
|---|---|
| PubChem CID | 146662381 |
| Molecular Formula | C22H20F2N8O3S |
| Molecular Weight | 514.52 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | N-(5-fluoro-2-nitrophenyl)-3-[2-[7-[(3-fluoro-2-pyridinyl)methylamino]-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]ethylamino]propanamide |
| SMILES | O=C(CCNCCc1nc2c(NCc3ncccc3F)ncnc2s1)Nc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H20F2N8O3S/c23-13-3-4-17(32(34)35)15(10-13)30-18(33)5-8-25-9-6-19-31-20-21(28-12-29-22(20)36-19)27-11-16-14(24)2-1-7-26-16/h1-4,7,10,12,25H,5-6,8-9,11H2,(H,30,33)(H,27,28,29) |
| InChIKey | ZNAPBKHRLBZINV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 147.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|