C22H23FN10S — CID 146662485
2-[2-[2-(1H-benzimidazol-2-yl)ethylamino]ethyl]-N-[(3-fluoro-2-pyridinyl)methyl]-5-hydrazinyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine (PubChem CID 146662485) has the molecular formula C22H23FN10S and a molecular weight of 478.56 g/mol. Its IUPAC name is 2-[2-[2-(1H-benzimidazol-2-yl)ethylamino]ethyl]-N-[(3-fluoro-2-pyridinyl)methyl]-5-hydrazinyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine.
| Compound Name | 2-[2-[2-(1H-benzimidazol-2-yl)ethylamino]ethyl]-N-[(3-fluoro-2-pyridinyl)methyl]-5-hydrazinyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 146662485 |
| Molecular Formula | C22H23FN10S |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 2-[2-[2-(1H-benzimidazol-2-yl)ethylamino]ethyl]-N-[(3-fluoro-2-pyridinyl)methyl]-5-hydrazinyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
| SMILES | NNc1nc(NCc2ncccc2F)c2nc(CCNCCc3nc4ccccc4[nH]3)sc2n1 |
| InChI | InChI=1S/C22H23FN10S/c23-13-4-3-9-26-16(13)12-27-20-19-21(32-22(31-20)33-24)34-18(30-19)8-11-25-10-7-17-28-14-5-1-2-6-15(14)29-17/h1-6,9,25H,7-8,10-12,24H2,(H,28,29)(H2,27,31,32,33) |
| InChIKey | QAPYRCYRULUUBG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 142.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|