C22H20FN9O2S — CID 146662609
N-[(3-fluoro-2-pyridinyl)methyl]-2-[2-[2-(6-nitro-1H-benzimidazol-2-yl)ethylamino]ethyl]-[1,3]thiazolo[5,4-d]pyrimidin-7-amine (PubChem CID 146662609) has the molecular formula C22H20FN9O2S and a molecular weight of 493.53 g/mol. Its IUPAC name is N-[(3-fluoro-2-pyridinyl)methyl]-2-[2-[2-(6-nitro-1H-benzimidazol-2-yl)ethylamino]ethyl]-[1,3]thiazolo[5,4-d]pyrimidin-7-amine.
| Compound Name | N-[(3-fluoro-2-pyridinyl)methyl]-2-[2-[2-(6-nitro-1H-benzimidazol-2-yl)ethylamino]ethyl]-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 146662609 |
| Molecular Formula | C22H20FN9O2S |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | N-[(3-fluoro-2-pyridinyl)methyl]-2-[2-[2-(6-nitro-1H-benzimidazol-2-yl)ethylamino]ethyl]-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
| SMILES | O=[N+]([O-])c1ccc2nc(CCNCCc3nc4c(NCc5ncccc5F)ncnc4s3)[nH]c2c1 |
| InChI | InChI=1S/C22H20FN9O2S/c23-14-2-1-7-25-17(14)11-26-21-20-22(28-12-27-21)35-19(31-20)6-9-24-8-5-18-29-15-4-3-13(32(33)34)10-16(15)30-18/h1-4,7,10,12,24H,5-6,8-9,11H2,(H,29,30)(H,26,27,28) |
| InChIKey | FBMDQPCORRYXNQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 147.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|