C21H21FN6O5 — CID 146662748
(3S,7R)-12-fluoro-18,18-dihydroxy-2,16-dioxa-8,14,20,24,25,27-hexazahexacyclo[23.3.1.03,7.08,28.010,15.022,26]nonacosa-1(29),10(15),11,13,22(26),23,27-heptaen-21-one (PubChem CID 146662748) has the molecular formula C21H21FN6O5 and a molecular weight of 456.43 g/mol. Its IUPAC name is (3S,7R)-12-fluoro-18,18-dihydroxy-2,16-dioxa-8,14,20,24,25,27-hexazahexacyclo[23.3.1.03,7.08,28.010,15.022,26]nonacosa-1(29),10(15),11,13,22(26),23,27-heptaen-21-one.
| Compound Name | (3S,7R)-12-fluoro-18,18-dihydroxy-2,16-dioxa-8,14,20,24,25,27-hexazahexacyclo[23.3.1.03,7.08,28.010,15.022,26]nonacosa-1(29),10(15),11,13,22(26),23,27-heptaen-21-one |
|---|---|
| PubChem CID | 146662748 |
| Molecular Formula | C21H21FN6O5 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | (3S,7R)-12-fluoro-18,18-dihydroxy-2,16-dioxa-8,14,20,24,25,27-hexazahexacyclo[23.3.1.03,7.08,28.010,15.022,26]nonacosa-1(29),10(15),11,13,22(26),23,27-heptaen-21-one |
| SMILES | O=C1NCC(O)(O)COc2ncc(F)cc2CN2c3nc4c1cnn4cc3O[C@H]1CCC[C@H]12 |
| InChI | InChI=1S/C21H21FN6O5/c22-12-4-11-7-27-14-2-1-3-15(14)33-16-8-28-17(26-18(16)27)13(6-25-28)19(29)24-9-21(30,31)10-32-20(11)23-5-12/h4-6,8,14-15,30-31H,1-3,7,9-10H2,(H,24,29)/t14-,15+/m1/s1 |
| InChIKey | WOVKAJQUBRLTGC-CABCVRRESA-N |
| XLogP | 0.39 |
| TPSA | 134.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|