C18H21NO10 — CID 146662946
5-amino-2-[(2R,3R,4R,5R)-3,4,5-triacetyloxyoxan-2-yl]oxybenzoic acid (PubChem CID 146662946) has the molecular formula C18H21NO10 and a molecular weight of 411.36 g/mol. Its IUPAC name is 5-amino-2-[(2R,3R,4R,5R)-3,4,5-triacetyloxyoxan-2-yl]oxybenzoic acid.
| Compound Name | 5-amino-2-[(2R,3R,4R,5R)-3,4,5-triacetyloxyoxan-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 146662946 |
| Molecular Formula | C18H21NO10 |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 5-amino-2-[(2R,3R,4R,5R)-3,4,5-triacetyloxyoxan-2-yl]oxybenzoic acid |
| SMILES | CC(=O)O[C@H]1[C@@H](Oc2ccc(N)cc2C(=O)O)OC[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H21NO10/c1-8(20)26-14-7-25-18(16(28-10(3)22)15(14)27-9(2)21)29-13-5-4-11(19)6-12(13)17(23)24/h4-6,14-16,18H,7,19H2,1-3H3,(H,23,24)/t14-,15-,16-,18-/m1/s1 |
| InChIKey | YUKDCQOSDHQSKI-YFHUEUNASA-N |
| XLogP | 0.50 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|