C24H41NO6S — CID 146665143
(4R)-4-[(3R,9S,14S)-3-hydroxy-10,13-dimethyl-7-(sulfoamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 146665143) has the molecular formula C24H41NO6S and a molecular weight of 471.66 g/mol. Its IUPAC name is (4R)-4-[(3R,9S,14S)-3-hydroxy-10,13-dimethyl-7-(sulfoamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(3R,9S,14S)-3-hydroxy-10,13-dimethyl-7-(sulfoamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 146665143 |
| Molecular Formula | C24H41NO6S |
| Molecular Weight | 471.66 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | (4R)-4-[(3R,9S,14S)-3-hydroxy-10,13-dimethyl-7-(sulfoamino)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | C[C@H](CCC(=O)O)C1CC[C@H]2C3C(NS(=O)(=O)O)CC4C[C@H](O)CCC4(C)[C@H]3CCC12C |
| InChI | InChI=1S/C24H41NO6S/c1-14(4-7-21(27)28)17-5-6-18-22-19(9-11-24(17,18)3)23(2)10-8-16(26)12-15(23)13-20(22)25-32(29,30)31/h14-20,22,25-26H,4-13H2,1-3H3,(H,27,28)(H,29,30,31)/t14-,15?,16-,17?,18+,19+,20?,22?,23?,24?/m1/s1 |
| InChIKey | ZCWQNMPTGAEWIZ-FMDQTNBTSA-N |
| XLogP | 3.88 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|