C23H25F2N7O4 — CID 146665384
N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-2,2-difluoro-2-[6-formyl-5-[(4-methyl-2-oxopiperazin-1-yl)methyl]-2-pyridinyl]acetamide (PubChem CID 146665384) has the molecular formula C23H25F2N7O4 and a molecular weight of 501.49 g/mol. Its IUPAC name is N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-2,2-difluoro-2-[6-formyl-5-[(4-methyl-2-oxopiperazin-1-yl)methyl]-2-pyridinyl]acetamide.
| Compound Name | N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-2,2-difluoro-2-[6-formyl-5-[(4-methyl-2-oxopiperazin-1-yl)methyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 146665384 |
| Molecular Formula | C23H25F2N7O4 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-2,2-difluoro-2-[6-formyl-5-[(4-methyl-2-oxopiperazin-1-yl)methyl]-2-pyridinyl]acetamide |
| SMILES | COCCNc1cc(NC(=O)C(F)(F)c2ccc(CN3CCN(C)CC3=O)c(C=O)n2)ncc1C#N |
| InChI | InChI=1S/C23H25F2N7O4/c1-31-6-7-32(21(34)13-31)12-15-3-4-19(29-18(15)14-33)23(24,25)22(35)30-20-9-17(27-5-8-36-2)16(10-26)11-28-20/h3-4,9,11,14H,5-8,12-13H2,1-2H3,(H2,27,28,30,35) |
| InChIKey | FYTUQNJSXBQTIM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|