About 3-[(3S)-pyrrolidin-3-yl]-1,3-oxazolidin-2-ol
3-[(3S)-pyrrolidin-3-yl]-1,3-oxazolidin-2-ol (PubChem CID 146665458) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 3-[(3S)-pyrrolidin-3-yl]-1,3-oxazolidin-2-ol.
Molecular Properties
| Compound Name | 3-[(3S)-pyrrolidin-3-yl]-1,3-oxazolidin-2-ol |
| PubChem CID | 146665458 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 3-[(3S)-pyrrolidin-3-yl]-1,3-oxazolidin-2-ol |
| SMILES | OC1OCCN1[C@H]1CCNC1 |
| InChI | InChI=1S/C7H14N2O2/c10-7-9(3-4-11-7)6-1-2-8-5-6/h6-8,10H,1-5H2/t6-,7?/m0/s1 |
| InChIKey | LZIQJJHDRXHBJA-PKPIPKONSA-N |
| XLogP | -1.04 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3S)-pyrrolidin-3-yl]-1,3-oxazolidin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3S)-pyrrolidin-3-yl]-1,3-oxazolidin-2-ol?
The IUPAC name of 3-[(3S)-pyrrolidin-3-yl]-1,3-oxazolidin-2-ol (CID 146665458) is 3-[(3S)-pyrrolidin-3-yl]-1,3-oxazolidin-2-ol.
What is the SMILES notation for 3-[(3S)-pyrrolidin-3-yl]-1,3-oxazolidin-2-ol?
The canonical SMILES for 3-[(3S)-pyrrolidin-3-yl]-1,3-oxazolidin-2-ol is OC1OCCN1[C@H]1CCNC1.
What is the InChIKey of 3-[(3S)-pyrrolidin-3-yl]-1,3-oxazolidin-2-ol?
The InChIKey is LZIQJJHDRXHBJA-PKPIPKONSA-N. The full InChI is InChI=1S/C7H14N2O2/c10-7-9(3-4-11-7)6-1-2-8-5-6/h6-8,10H,1-5H2/t6-,7?/m0/s1.
What are the key properties of 3-[(3S)-pyrrolidin-3-yl]-1,3-oxazolidin-2-ol?
3-[(3S)-pyrrolidin-3-yl]-1,3-oxazolidin-2-ol has a molecular weight of 158.20 g/mol, XLogP of -1.04, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3S)-pyrrolidin-3-yl]-1,3-oxazolidin-2-ol is sourced from PubChem (CID 146665458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).