About methyl 4-oxooxane-3-carboxylate
methyl 4-oxooxane-3-carboxylate (PubChem CID 14666555) has the molecular formula C7H10O4
and a molecular weight of 158.15 g/mol. Its IUPAC name is methyl 4-oxooxane-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4-oxooxane-3-carboxylate |
| PubChem CID | 14666555 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | methyl 4-oxooxane-3-carboxylate |
| SMILES | COC(=O)C1COCCC1=O |
| InChI | InChI=1S/C7H10O4/c1-10-7(9)5-4-11-3-2-6(5)8/h5H,2-4H2,1H3 |
| InChIKey | SOWMVLQIMWETEK-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-oxooxane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-oxooxane-3-carboxylate?
The IUPAC name of methyl 4-oxooxane-3-carboxylate (CID 14666555) is methyl 4-oxooxane-3-carboxylate.
What is the SMILES notation for methyl 4-oxooxane-3-carboxylate?
The canonical SMILES for methyl 4-oxooxane-3-carboxylate is COC(=O)C1COCCC1=O.
What is the InChIKey of methyl 4-oxooxane-3-carboxylate?
The InChIKey is SOWMVLQIMWETEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4/c1-10-7(9)5-4-11-3-2-6(5)8/h5H,2-4H2,1H3.
What are the key properties of methyl 4-oxooxane-3-carboxylate?
methyl 4-oxooxane-3-carboxylate has a molecular weight of 158.15 g/mol, XLogP of -0.23, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-oxooxane-3-carboxylate is sourced from PubChem (CID 14666555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).