C14H28N2O5 — CID 146665807
3-[2-[[3-(aminomethoxy)-3-methylbutanoyl]amino]propoxy]-3-methylbutanoic acid (PubChem CID 146665807) has the molecular formula C14H28N2O5 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-[2-[[3-(aminomethoxy)-3-methylbutanoyl]amino]propoxy]-3-methylbutanoic acid.
| Compound Name | 3-[2-[[3-(aminomethoxy)-3-methylbutanoyl]amino]propoxy]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 146665807 |
| Molecular Formula | C14H28N2O5 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 3-[2-[[3-(aminomethoxy)-3-methylbutanoyl]amino]propoxy]-3-methylbutanoic acid |
| SMILES | CC(COC(C)(C)CC(=O)O)NC(=O)CC(C)(C)OCN |
| InChI | InChI=1S/C14H28N2O5/c1-10(8-20-14(4,5)7-12(18)19)16-11(17)6-13(2,3)21-9-15/h10H,6-9,15H2,1-5H3,(H,16,17)(H,18,19) |
| InChIKey | KRNFYMQXCHDRKX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|