C62H62N2O2 — CID 146666142
5-N,5-N,21-N,21-N-tetrakis(4-tert-butylphenyl)-10,16-dioxahexacyclo[11.11.0.03,11.04,9.015,23.017,22]tetracosa-1,3(11),4,6,8,12,14,17,19,21,23-undecaene-5,21-diamine (PubChem CID 146666142) has the molecular formula C62H62N2O2 and a molecular weight of 867.19 g/mol. Its IUPAC name is 5-N,5-N,21-N,21-N-tetrakis(4-tert-butylphenyl)-10,16-dioxahexacyclo[11.11.0.03,11.04,9.015,23.017,22]tetracosa-1,3(11),4,6,8,12,14,17,19,21,23-undecaene-5,21-diamine.
| Compound Name | 5-N,5-N,21-N,21-N-tetrakis(4-tert-butylphenyl)-10,16-dioxahexacyclo[11.11.0.03,11.04,9.015,23.017,22]tetracosa-1,3(11),4,6,8,12,14,17,19,21,23-undecaene-5,21-diamine |
|---|---|
| PubChem CID | 146666142 |
| Molecular Formula | C62H62N2O2 |
| Molecular Weight | 867.19 g/mol |
| Exact Mass | 866.48 |
| IUPAC Name | 5-N,5-N,21-N,21-N-tetrakis(4-tert-butylphenyl)-10,16-dioxahexacyclo[11.11.0.03,11.04,9.015,23.017,22]tetracosa-1,3(11),4,6,8,12,14,17,19,21,23-undecaene-5,21-diamine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cccc3oc4cc5cc6oc7cccc(N(c8ccc(C(C)(C)C)cc8)c8ccc(C(C)(C)C)cc8)c7c6cc5cc4c23)cc1 |
| InChI | InChI=1S/C62H62N2O2/c1-59(2,3)41-19-27-45(28-20-41)63(46-29-21-42(22-30-46)60(4,5)6)51-15-13-17-53-57(51)49-35-39-36-50-56(38-40(39)37-55(49)65-53)66-54-18-14-16-52(58(50)54)64(47-31-23-43(24-32-47)61(7,8)9)48-33-25-44(26-34-48)62(10,11)12/h13-38H,1-12H3 |
| InChIKey | LFQITWFIQFHTKZ-UHFFFAOYSA-N |
| XLogP | 18.77 |
| TPSA | 32.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.19 |
| LogP ≤ 5 | 18.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |