C43H27N5O2 — CID 146666280
2-[4-(7,8-dipyridin-2-yldibenzo-p-dioxin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 146666280) has the molecular formula C43H27N5O2 and a molecular weight of 645.72 g/mol. Its IUPAC name is 2-[4-(7,8-dipyridin-2-yldibenzo-p-dioxin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-(7,8-dipyridin-2-yldibenzo-p-dioxin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 146666280 |
| Molecular Formula | C43H27N5O2 |
| Molecular Weight | 645.72 g/mol |
| Exact Mass | 645.22 |
| IUPAC Name | 2-[4-(7,8-dipyridin-2-yldibenzo-p-dioxin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc5c(c4)Oc4cc(-c6ccccn6)c(-c6ccccn6)cc4O5)cc3)n2)cc1 |
| InChI | InChI=1S/C43H27N5O2/c1-3-11-29(12-4-1)41-46-42(30-13-5-2-6-14-30)48-43(47-41)31-19-17-28(18-20-31)32-21-22-37-38(25-32)50-40-27-34(36-16-8-10-24-45-36)33(26-39(40)49-37)35-15-7-9-23-44-35/h1-27H |
| InChIKey | XLEWJWMHPXCENF-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 82.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.72 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |