About 3-(2,2-dimethylpropyl)-9,9-dimethylxanthene
3-(2,2-dimethylpropyl)-9,9-dimethylxanthene (PubChem CID 146666376) has the molecular formula C20H24O
and a molecular weight of 280.41 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-9,9-dimethylxanthene.
Molecular Properties
| Compound Name | 3-(2,2-dimethylpropyl)-9,9-dimethylxanthene |
| PubChem CID | 146666376 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-9,9-dimethylxanthene |
| SMILES | CC(C)(C)Cc1ccc2c(c1)Oc1ccccc1C2(C)C |
| InChI | InChI=1S/C20H24O/c1-19(2,3)13-14-10-11-16-18(12-14)21-17-9-7-6-8-15(17)20(16,4)5/h6-12H,13H2,1-5H3 |
| InChIKey | LSTGMHSMKGBCBT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2,2-dimethylpropyl)-9,9-dimethylxanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethylpropyl)-9,9-dimethylxanthene?
The IUPAC name of 3-(2,2-dimethylpropyl)-9,9-dimethylxanthene (CID 146666376) is 3-(2,2-dimethylpropyl)-9,9-dimethylxanthene.
What is the SMILES notation for 3-(2,2-dimethylpropyl)-9,9-dimethylxanthene?
The canonical SMILES for 3-(2,2-dimethylpropyl)-9,9-dimethylxanthene is CC(C)(C)Cc1ccc2c(c1)Oc1ccccc1C2(C)C.
What is the InChIKey of 3-(2,2-dimethylpropyl)-9,9-dimethylxanthene?
The InChIKey is LSTGMHSMKGBCBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O/c1-19(2,3)13-14-10-11-16-18(12-14)21-17-9-7-6-8-15(17)20(16,4)5/h6-12H,13H2,1-5H3.
What are the key properties of 3-(2,2-dimethylpropyl)-9,9-dimethylxanthene?
3-(2,2-dimethylpropyl)-9,9-dimethylxanthene has a molecular weight of 280.41 g/mol, XLogP of 5.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethylpropyl)-9,9-dimethylxanthene is sourced from PubChem (CID 146666376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).