C28H26ClF3N4O5 — CID 146666488
2-[[3-chloro-4-(trifluoromethyl)anilino]methyl]-3-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]pentanal (PubChem CID 146666488) has the molecular formula C28H26ClF3N4O5 and a molecular weight of 590.99 g/mol. Its IUPAC name is 2-[[3-chloro-4-(trifluoromethyl)anilino]methyl]-3-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]pentanal.
| Compound Name | 2-[[3-chloro-4-(trifluoromethyl)anilino]methyl]-3-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]pentanal |
|---|---|
| PubChem CID | 146666488 |
| Molecular Formula | C28H26ClF3N4O5 |
| Molecular Weight | 590.99 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | 2-[[3-chloro-4-(trifluoromethyl)anilino]methyl]-3-[3-[[1-(2,6-dioxopiperidin-3-yl)-2,5-dioxopyrrol-3-yl]amino]phenyl]pentanal |
| SMILES | CCC(c1cccc(NC2=CC(=O)N(C3CCC(=O)NC3=O)C2=O)c1)C(C=O)CNc1ccc(C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C28H26ClF3N4O5/c1-2-19(16(14-37)13-33-17-6-7-20(21(29)11-17)28(30,31)32)15-4-3-5-18(10-15)34-22-12-25(39)36(27(22)41)23-8-9-24(38)35-26(23)40/h3-7,10-12,14,16,19,23,33-34H,2,8-9,13H2,1H3,(H,35,38,40) |
| InChIKey | JWYPYHVLBWFQCC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.99 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|