C30H42O10 — CID 146666513
[5,6,11-trihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-13-[(E)-2-methylbut-2-enoyl]oxy-7-oxo-3-oxapentacyclo[12.1.1.01,11.02,4.06,10]hexadec-8-en-14-yl] 2-methylbutanoate (PubChem CID 146666513) has the molecular formula C30H42O10 and a molecular weight of 562.66 g/mol. Its IUPAC name is [5,6,11-trihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-13-[(E)-2-methylbut-2-enoyl]oxy-7-oxo-3-oxapentacyclo[12.1.1.01,11.02,4.06,10]hexadec-8-en-14-yl] 2-methylbutanoate.
| Compound Name | [5,6,11-trihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-13-[(E)-2-methylbut-2-enoyl]oxy-7-oxo-3-oxapentacyclo[12.1.1.01,11.02,4.06,10]hexadec-8-en-14-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 146666513 |
| Molecular Formula | C30H42O10 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | [5,6,11-trihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-13-[(E)-2-methylbut-2-enoyl]oxy-7-oxo-3-oxapentacyclo[12.1.1.01,11.02,4.06,10]hexadec-8-en-14-yl] 2-methylbutanoate |
| SMILES | C/C=C(\C)C(=O)OC1C(C)C2(O)C3C=C(C)C(=O)C3(O)C(O)C3(CO)OC3C23CC1(OC(=O)C(C)CC)C3(C)C |
| InChI | InChI=1S/C30H42O10/c1-9-14(3)21(33)38-20-17(6)30(37)18-11-16(5)19(32)29(18,36)23(35)26(13-31)24(40-26)27(30)12-28(20,25(27,7)8)39-22(34)15(4)10-2/h9,11,15,17-18,20,23-24,31,35-37H,10,12-13H2,1-8H3/b14-9+ |
| InChIKey | VVZJFNXUFZHIEO-NTEUORMPSA-N |
| XLogP | 1.37 |
| TPSA | 163.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|