C14H23N — CID 146666517
(3S,4S)-3-(2-methylprop-2-enyl)-2,4-bis(prop-1-en-2-yl)pyrrolidine (PubChem CID 146666517) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (3S,4S)-3-(2-methylprop-2-enyl)-2,4-bis(prop-1-en-2-yl)pyrrolidine.
| Compound Name | (3S,4S)-3-(2-methylprop-2-enyl)-2,4-bis(prop-1-en-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 146666517 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (3S,4S)-3-(2-methylprop-2-enyl)-2,4-bis(prop-1-en-2-yl)pyrrolidine |
| SMILES | C=C(C)C[C@@H]1C(C(=C)C)NC[C@@H]1C(=C)C |
| InChI | InChI=1S/C14H23N/c1-9(2)7-12-13(10(3)4)8-15-14(12)11(5)6/h12-15H,1,3,5,7-8H2,2,4,6H3/t12-,13+,14?/m0/s1 |
| InChIKey | UNTIYDQYPHDJHH-WLDKUNSKSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|