About 2-methyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octan-8-ol
2-methyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octan-8-ol (PubChem CID 146666664) has the molecular formula C7H13NO3S
and a molecular weight of 191.25 g/mol. Its IUPAC name is 2-methyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octan-8-ol.
Analyze 2-methyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octan-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octan-8-ol?
The IUPAC name of 2-methyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octan-8-ol (CID 146666664) is 2-methyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octan-8-ol.
What is the SMILES notation for 2-methyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octan-8-ol?
The canonical SMILES for 2-methyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octan-8-ol is CN1CC2(C1)C(O)CCS2(=O)=O.
What is the InChIKey of 2-methyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octan-8-ol?
The InChIKey is KVNIAMHHFWCXGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3S/c1-8-4-7(5-8)6(9)2-3-12(7,10)11/h6,9H,2-5H2,1H3.
What are the key properties of 2-methyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octan-8-ol?
2-methyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octan-8-ol has a molecular weight of 191.25 g/mol, XLogP of -1.15, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octan-8-ol is sourced from PubChem (CID 146666664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).