About [1-(2,4,6-trimethylphenyl)sulfanylpiperidin-4-yl]methanol
[1-(2,4,6-trimethylphenyl)sulfanylpiperidin-4-yl]methanol (PubChem CID 146666700) has the molecular formula C15H23NOS
and a molecular weight of 265.42 g/mol. Its IUPAC name is [1-(2,4,6-trimethylphenyl)sulfanylpiperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-(2,4,6-trimethylphenyl)sulfanylpiperidin-4-yl]methanol |
| PubChem CID | 146666700 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | [1-(2,4,6-trimethylphenyl)sulfanylpiperidin-4-yl]methanol |
| SMILES | Cc1cc(C)c(SN2CCC(CO)CC2)c(C)c1 |
| InChI | InChI=1S/C15H23NOS/c1-11-8-12(2)15(13(3)9-11)18-16-6-4-14(10-17)5-7-16/h8-9,14,17H,4-7,10H2,1-3H3 |
| InChIKey | SCVXLLPKVSMSIZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,4,6-trimethylphenyl)sulfanylpiperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,4,6-trimethylphenyl)sulfanylpiperidin-4-yl]methanol?
The IUPAC name of [1-(2,4,6-trimethylphenyl)sulfanylpiperidin-4-yl]methanol (CID 146666700) is [1-(2,4,6-trimethylphenyl)sulfanylpiperidin-4-yl]methanol.
What is the SMILES notation for [1-(2,4,6-trimethylphenyl)sulfanylpiperidin-4-yl]methanol?
The canonical SMILES for [1-(2,4,6-trimethylphenyl)sulfanylpiperidin-4-yl]methanol is Cc1cc(C)c(SN2CCC(CO)CC2)c(C)c1.
What is the InChIKey of [1-(2,4,6-trimethylphenyl)sulfanylpiperidin-4-yl]methanol?
The InChIKey is SCVXLLPKVSMSIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NOS/c1-11-8-12(2)15(13(3)9-11)18-16-6-4-14(10-17)5-7-16/h8-9,14,17H,4-7,10H2,1-3H3.
What are the key properties of [1-(2,4,6-trimethylphenyl)sulfanylpiperidin-4-yl]methanol?
[1-(2,4,6-trimethylphenyl)sulfanylpiperidin-4-yl]methanol has a molecular weight of 265.42 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,4,6-trimethylphenyl)sulfanylpiperidin-4-yl]methanol is sourced from PubChem (CID 146666700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).