C18H24ClF3N2O2S — CID 146666937
1-[1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-4-methylpiperidine (PubChem CID 146666937) has the molecular formula C18H24ClF3N2O2S and a molecular weight of 424.92 g/mol. Its IUPAC name is 1-[1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-4-methylpiperidine.
| Compound Name | 1-[1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-4-methylpiperidine |
|---|---|
| PubChem CID | 146666937 |
| Molecular Formula | C18H24ClF3N2O2S |
| Molecular Weight | 424.92 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 1-[1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]-4-methylpiperidine |
| SMILES | CC1CCN(C2CCN(S(=O)(=O)c3ccc(Cl)c(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C18H24ClF3N2O2S/c1-13-4-8-23(9-5-13)14-6-10-24(11-7-14)27(25,26)15-2-3-17(19)16(12-15)18(20,21)22/h2-3,12-14H,4-11H2,1H3 |
| InChIKey | QSTKIFNFPVTONK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.92 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |