About 10-(hydroxymethyl)-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one
10-(hydroxymethyl)-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one (PubChem CID 14666699) has the molecular formula C18H15NO2S
and a molecular weight of 309.39 g/mol. Its IUPAC name is 10-(hydroxymethyl)-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one.
Molecular Properties
| Compound Name | 10-(hydroxymethyl)-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one |
| PubChem CID | 14666699 |
| Molecular Formula | C18H15NO2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 10-(hydroxymethyl)-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one |
| SMILES | O=c1c(-c2ccccc2)cc(CO)c2n1CCc1ccsc1-2 |
| InChI | InChI=1S/C18H15NO2S/c20-11-14-10-15(12-4-2-1-3-5-12)18(21)19-8-6-13-7-9-22-17(13)16(14)19/h1-5,7,9-10,20H,6,8,11H2 |
| InChIKey | SYQHAHDQQGSRNG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-(hydroxymethyl)-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(hydroxymethyl)-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one?
The IUPAC name of 10-(hydroxymethyl)-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one (CID 14666699) is 10-(hydroxymethyl)-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one.
What is the SMILES notation for 10-(hydroxymethyl)-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one?
The canonical SMILES for 10-(hydroxymethyl)-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one is O=c1c(-c2ccccc2)cc(CO)c2n1CCc1ccsc1-2.
What is the InChIKey of 10-(hydroxymethyl)-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one?
The InChIKey is SYQHAHDQQGSRNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO2S/c20-11-14-10-15(12-4-2-1-3-5-12)18(21)19-8-6-13-7-9-22-17(13)16(14)19/h1-5,7,9-10,20H,6,8,11H2.
What are the key properties of 10-(hydroxymethyl)-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one?
10-(hydroxymethyl)-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one has a molecular weight of 309.39 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(hydroxymethyl)-8-phenyl-4,5-dihydrothieno[2,3-a]quinolizin-7-one is sourced from PubChem (CID 14666699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).