C17H11Cl2NOS2 — CID 14666702
8,14-dichloro-12-phenyl-3,7-dithia-10-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,12-tetraen-11-one (PubChem CID 14666702) has the molecular formula C17H11Cl2NOS2 and a molecular weight of 380.32 g/mol. Its IUPAC name is 8,14-dichloro-12-phenyl-3,7-dithia-10-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,12-tetraen-11-one.
| Compound Name | 8,14-dichloro-12-phenyl-3,7-dithia-10-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,12-tetraen-11-one |
|---|---|
| PubChem CID | 14666702 |
| Molecular Formula | C17H11Cl2NOS2 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | 8,14-dichloro-12-phenyl-3,7-dithia-10-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,12-tetraen-11-one |
| SMILES | O=c1c(-c2ccccc2)cc(Cl)c2n1CC(Cl)Sc1ccsc1-2 |
| InChI | InChI=1S/C17H11Cl2NOS2/c18-12-8-11(10-4-2-1-3-5-10)17(21)20-9-14(19)23-13-6-7-22-16(13)15(12)20/h1-8,14H,9H2 |
| InChIKey | RUCDCUPZCHMYGO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|