C19H13NO3S2 — CID 14666703
methyl 11-oxo-12-phenyl-3,7-dithia-10-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,12-pentaene-14-carboxylate (PubChem CID 14666703) has the molecular formula C19H13NO3S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is methyl 11-oxo-12-phenyl-3,7-dithia-10-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,12-pentaene-14-carboxylate.
| Compound Name | methyl 11-oxo-12-phenyl-3,7-dithia-10-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,12-pentaene-14-carboxylate |
|---|---|
| PubChem CID | 14666703 |
| Molecular Formula | C19H13NO3S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | methyl 11-oxo-12-phenyl-3,7-dithia-10-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,12-pentaene-14-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)c(=O)n2c1-c1sccc1SC=C2 |
| InChI | InChI=1S/C19H13NO3S2/c1-23-19(22)14-11-13(12-5-3-2-4-6-12)18(21)20-8-10-24-15-7-9-25-17(15)16(14)20/h2-11H,1H3 |
| InChIKey | CLUTUXRUNHWJFC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |