C30H29N5O2 — CID 146667089
6-ethoxy-4-[6-[4-(4-phenylbut-3-ynoxy)piperidin-1-yl]-3-pyridinyl]pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 146667089) has the molecular formula C30H29N5O2 and a molecular weight of 491.60 g/mol. Its IUPAC name is 6-ethoxy-4-[6-[4-(4-phenylbut-3-ynoxy)piperidin-1-yl]-3-pyridinyl]pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-ethoxy-4-[6-[4-(4-phenylbut-3-ynoxy)piperidin-1-yl]-3-pyridinyl]pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 146667089 |
| Molecular Formula | C30H29N5O2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 6-ethoxy-4-[6-[4-(4-phenylbut-3-ynoxy)piperidin-1-yl]-3-pyridinyl]pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | CCOc1cc(-c2ccc(N3CCC(OCCC#Cc4ccccc4)CC3)nc2)c2c(C#N)cnn2c1 |
| InChI | InChI=1S/C30H29N5O2/c1-2-36-27-18-28(30-25(19-31)21-33-35(30)22-27)24-11-12-29(32-20-24)34-15-13-26(14-16-34)37-17-7-6-10-23-8-4-3-5-9-23/h3-5,8-9,11-12,18,20-22,26H,2,7,13-17H2,1H3 |
| InChIKey | QXOQOWREMTWWCE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 75.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|