C18H13NO5 — CID 146667345
ethyl 3-methyl-2,4-dioxo-13-oxa-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),5,7,9(16),10(14),11-hexaene-12-carboxylate (PubChem CID 146667345) has the molecular formula C18H13NO5 and a molecular weight of 323.30 g/mol. Its IUPAC name is ethyl 3-methyl-2,4-dioxo-13-oxa-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),5,7,9(16),10(14),11-hexaene-12-carboxylate.
| Compound Name | ethyl 3-methyl-2,4-dioxo-13-oxa-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),5,7,9(16),10(14),11-hexaene-12-carboxylate |
|---|---|
| PubChem CID | 146667345 |
| Molecular Formula | C18H13NO5 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | ethyl 3-methyl-2,4-dioxo-13-oxa-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),5,7,9(16),10(14),11-hexaene-12-carboxylate |
| SMILES | CCOC(=O)c1cc2c(cc3c4c(cccc42)C(=O)N(C)C3=O)o1 |
| InChI | InChI=1S/C18H13NO5/c1-3-23-18(22)14-7-11-9-5-4-6-10-15(9)12(8-13(11)24-14)17(21)19(2)16(10)20/h4-8H,3H2,1-2H3 |
| InChIKey | QEYONONIMSBSSL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|