C13H16IN — CID 146667407
7-iodo-6-methyl-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene (PubChem CID 146667407) has the molecular formula C13H16IN and a molecular weight of 313.18 g/mol. Its IUPAC name is 7-iodo-6-methyl-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene.
| Compound Name | 7-iodo-6-methyl-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene |
|---|---|
| PubChem CID | 146667407 |
| Molecular Formula | C13H16IN |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 7-iodo-6-methyl-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene |
| SMILES | Cc1c(I)cc2c3c1CCCN3CCC2 |
| InChI | InChI=1S/C13H16IN/c1-9-11-5-3-7-15-6-2-4-10(13(11)15)8-12(9)14/h8H,2-7H2,1H3 |
| InChIKey | JCGLGDNJTYZRLP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|