C12H28N2 — CID 146667491
6-N,2,4,4,6-pentamethylheptane-2,6-diamine (PubChem CID 146667491) has the molecular formula C12H28N2 and a molecular weight of 200.37 g/mol. Its IUPAC name is 6-N,2,4,4,6-pentamethylheptane-2,6-diamine.
| Compound Name | 6-N,2,4,4,6-pentamethylheptane-2,6-diamine |
|---|---|
| PubChem CID | 146667491 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | 6-N,2,4,4,6-pentamethylheptane-2,6-diamine |
| SMILES | CNC(C)(C)CC(C)(C)CC(C)(C)N |
| InChI | InChI=1S/C12H28N2/c1-10(2,8-11(3,4)13)9-12(5,6)14-7/h14H,8-9,13H2,1-7H3 |
| InChIKey | QNZWRTLBSXIFNP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |